C13H24N2 — CID 123687525
2,4-dimethyl-1-N-(3-methylbut-3-enyl)hexane-1,3-diimine (PubChem CID 123687525) has the molecular formula C13H24N2 and a molecular weight of 208.35 g/mol. Its IUPAC name is 2,4-dimethyl-1-N-(3-methylbut-3-enyl)hexane-1,3-diimine.
| Compound Name | 2,4-dimethyl-1-N-(3-methylbut-3-enyl)hexane-1,3-diimine |
|---|---|
| PubChem CID | 123687525 |
| Molecular Formula | C13H24N2 |
| Molecular Weight | 208.35 g/mol |
| Exact Mass | 208.19 |
| IUPAC Name | 2,4-dimethyl-1-N-(3-methylbut-3-enyl)hexane-1,3-diimine |
| SMILES | [H]/N=C(/C(C)/C=N/CCC(=C)C)C(C)CC |
| InChI | InChI=1S/C13H24N2/c1-6-11(4)13(14)12(5)9-15-8-7-10(2)3/h9,11-12,14H,2,6-8H2,1,3-5H3/b14-13+,15-9+ |
| InChIKey | JUVCSYHCXLRVAA-FYXBLBNSSA-N |
| XLogP | 3.73 |
| TPSA | 36.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.35 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|