C10H18N2 — CID 140575833
4-prop-1-en-2-ylheptane-1,6-diimine (PubChem CID 140575833) has the molecular formula C10H18N2 and a molecular weight of 166.27 g/mol. Its IUPAC name is 4-prop-1-en-2-ylheptane-1,6-diimine.
| Compound Name | 4-prop-1-en-2-ylheptane-1,6-diimine |
|---|---|
| PubChem CID | 140575833 |
| Molecular Formula | C10H18N2 |
| Molecular Weight | 166.27 g/mol |
| Exact Mass | 166.15 |
| IUPAC Name | 4-prop-1-en-2-ylheptane-1,6-diimine |
| SMILES | [H]/N=C/CCC(C/C(C)=N/[H])C(=C)C |
| InChI | InChI=1S/C10H18N2/c1-8(2)10(5-4-6-11)7-9(3)12/h6,10-12H,1,4-5,7H2,2-3H3/b11-6+,12-9+ |
| InChIKey | DWTZOHYRXDNTMU-MOPWJCKASA-N |
| XLogP | 3.04 |
| TPSA | 47.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.27 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|