C11H20N2 — CID 123819837
2-N-but-3-enyl-3-methylhexane-2,4-diimine (PubChem CID 123819837) has the molecular formula C11H20N2 and a molecular weight of 180.29 g/mol. Its IUPAC name is 2-N-but-3-enyl-3-methylhexane-2,4-diimine.
| Compound Name | 2-N-but-3-enyl-3-methylhexane-2,4-diimine |
|---|---|
| PubChem CID | 123819837 |
| Molecular Formula | C11H20N2 |
| Molecular Weight | 180.29 g/mol |
| Exact Mass | 180.16 |
| IUPAC Name | 2-N-but-3-enyl-3-methylhexane-2,4-diimine |
| SMILES | [H]/N=C(\CC)C(C)/C(C)=N/CCC=C |
| InChI | InChI=1S/C11H20N2/c1-5-7-8-13-10(4)9(3)11(12)6-2/h5,9,12H,1,6-8H2,2-4H3/b12-11+,13-10+ |
| InChIKey | GKYPTKGCOSXEJI-JASOSIDASA-N |
| XLogP | 3.09 |
| TPSA | 36.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.29 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|