C13H24N2 — CID 123857206
2-N-(5-methylhept-6-en-2-yl)pentane-2,3-diimine (PubChem CID 123857206) has the molecular formula C13H24N2 and a molecular weight of 208.35 g/mol. Its IUPAC name is 2-N-(5-methylhept-6-en-2-yl)pentane-2,3-diimine.
| Compound Name | 2-N-(5-methylhept-6-en-2-yl)pentane-2,3-diimine |
|---|---|
| PubChem CID | 123857206 |
| Molecular Formula | C13H24N2 |
| Molecular Weight | 208.35 g/mol |
| Exact Mass | 208.19 |
| IUPAC Name | 2-N-(5-methylhept-6-en-2-yl)pentane-2,3-diimine |
| SMILES | [H]/N=C(CC)/C(C)=N/C(C)CCC(C)C=C |
| InChI | InChI=1S/C13H24N2/c1-6-10(3)8-9-11(4)15-12(5)13(14)7-2/h6,10-11,14H,1,7-9H2,2-5H3/b14-13+,15-12+ |
| InChIKey | BVTRNEVPNGWIDT-RCQWFYMDSA-N |
| XLogP | 3.87 |
| TPSA | 36.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.35 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|