C13H25N3 — CID 144799384
3-ethyl-5-(2-methylprop-1-enylimino)hept-6-ene-1,4-diamine (PubChem CID 144799384) has the molecular formula C13H25N3 and a molecular weight of 223.36 g/mol. Its IUPAC name is 3-ethyl-5-(2-methylprop-1-enylimino)hept-6-ene-1,4-diamine.
| Compound Name | 3-ethyl-5-(2-methylprop-1-enylimino)hept-6-ene-1,4-diamine |
|---|---|
| PubChem CID | 144799384 |
| Molecular Formula | C13H25N3 |
| Molecular Weight | 223.36 g/mol |
| Exact Mass | 223.20 |
| IUPAC Name | 3-ethyl-5-(2-methylprop-1-enylimino)hept-6-ene-1,4-diamine |
| SMILES | C=C/C(=N\C=C(C)C)C(N)C(CC)CCN |
| InChI | InChI=1S/C13H25N3/c1-5-11(7-8-14)13(15)12(6-2)16-9-10(3)4/h6,9,11,13H,2,5,7-8,14-15H2,1,3-4H3/b16-12+ |
| InChIKey | UIDLLZONJBWGMG-FOWTUZBSSA-N |
| XLogP | 2.24 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.36 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|