C9H16N2 — CID 140575842
4-ethenylheptane-1,6-diimine (PubChem CID 140575842) has the molecular formula C9H16N2 and a molecular weight of 152.24 g/mol. Its IUPAC name is 4-ethenylheptane-1,6-diimine.
| Compound Name | 4-ethenylheptane-1,6-diimine |
|---|---|
| PubChem CID | 140575842 |
| Molecular Formula | C9H16N2 |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.13 |
| IUPAC Name | 4-ethenylheptane-1,6-diimine |
| SMILES | [H]/N=C/CCC(C=C)C/C(C)=N/[H] |
| InChI | InChI=1S/C9H16N2/c1-3-9(5-4-6-10)7-8(2)11/h3,6,9-11H,1,4-5,7H2,2H3/b10-6+,11-8+ |
| InChIKey | IILBXSVHBJTQRE-NSJFVGFPSA-N |
| XLogP | 2.65 |
| TPSA | 47.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|