C11H18N2 — CID 140575852
3-buta-1,3-dien-2-ylheptane-1,6-diimine (PubChem CID 140575852) has the molecular formula C11H18N2 and a molecular weight of 178.28 g/mol. Its IUPAC name is 3-buta-1,3-dien-2-ylheptane-1,6-diimine.
| Compound Name | 3-buta-1,3-dien-2-ylheptane-1,6-diimine |
|---|---|
| PubChem CID | 140575852 |
| Molecular Formula | C11H18N2 |
| Molecular Weight | 178.28 g/mol |
| Exact Mass | 178.15 |
| IUPAC Name | 3-buta-1,3-dien-2-ylheptane-1,6-diimine |
| SMILES | [H]/N=C/CC(CC/C(C)=N/[H])C(=C)C=C |
| InChI | InChI=1S/C11H18N2/c1-4-9(2)11(7-8-12)6-5-10(3)13/h4,8,11-13H,1-2,5-7H2,3H3/b12-8+,13-10+ |
| InChIKey | YMPUMMCGBOTDKK-SDCOAONHSA-N |
| XLogP | 3.20 |
| TPSA | 47.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.28 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|