C9H16N2 — CID 140575858
3-ethenylheptane-1,6-diimine (PubChem CID 140575858) has the molecular formula C9H16N2 and a molecular weight of 152.24 g/mol. Its IUPAC name is 3-ethenylheptane-1,6-diimine.
| Compound Name | 3-ethenylheptane-1,6-diimine |
|---|---|
| PubChem CID | 140575858 |
| Molecular Formula | C9H16N2 |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.13 |
| IUPAC Name | 3-ethenylheptane-1,6-diimine |
| SMILES | [H]/N=C/CC(C=C)CC/C(C)=N/[H] |
| InChI | InChI=1S/C9H16N2/c1-3-9(6-7-10)5-4-8(2)11/h3,7,9-11H,1,4-6H2,2H3/b10-7+,11-8+ |
| InChIKey | SDBGUXXWXJGGBY-AMMQDNIMSA-N |
| XLogP | 2.65 |
| TPSA | 47.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|