C28H32N5O4S2+ — CID 123688201
3-cyclopentyl-N-(5-methoxy-[1,3]thiazolo[5,4-b]pyridin-2-yl)-2-[4-(2-pyridin-1-ium-1-ylethylsulfamoyl)phenyl]propanamide (PubChem CID 123688201) has the molecular formula C28H32N5O4S2+ and a molecular weight of 566.73 g/mol. Its IUPAC name is 3-cyclopentyl-N-(5-methoxy-[1,3]thiazolo[5,4-b]pyridin-2-yl)-2-[4-(2-pyridin-1-ium-1-ylethylsulfamoyl)phenyl]propanamide.
| Compound Name | 3-cyclopentyl-N-(5-methoxy-[1,3]thiazolo[5,4-b]pyridin-2-yl)-2-[4-(2-pyridin-1-ium-1-ylethylsulfamoyl)phenyl]propanamide |
|---|---|
| PubChem CID | 123688201 |
| Molecular Formula | C28H32N5O4S2+ |
| Molecular Weight | 566.73 g/mol |
| Exact Mass | 566.19 |
| IUPAC Name | 3-cyclopentyl-N-(5-methoxy-[1,3]thiazolo[5,4-b]pyridin-2-yl)-2-[4-(2-pyridin-1-ium-1-ylethylsulfamoyl)phenyl]propanamide |
| SMILES | COc1ccc2nc(NC(=O)C(CC3CCCC3)c3ccc(S(=O)(=O)NCC[n+]4ccccc4)cc3)sc2n1 |
| InChI | InChI=1S/C28H31N5O4S2/c1-37-25-14-13-24-27(31-25)38-28(30-24)32-26(34)23(19-20-7-3-4-8-20)21-9-11-22(12-10-21)39(35,36)29-15-18-33-16-5-2-6-17-33/h2,5-6,9-14,16-17,20,23,29H,3-4,7-8,15,18-19H2,1H3/p+1 |
| InChIKey | XCOPLFLSIFYCDS-UHFFFAOYSA-O |
| XLogP | 4.27 |
| TPSA | 114.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.73 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|