C24H30N4O5S2 — CID 87236215
3-cyclopentyl-2-[4-[ethyl(methoxy)sulfamoyl]phenyl]-N-(5-methoxy-[1,3]thiazolo[5,4-b]pyridin-2-yl)propanamide (PubChem CID 87236215) has the molecular formula C24H30N4O5S2 and a molecular weight of 518.66 g/mol. Its IUPAC name is 3-cyclopentyl-2-[4-[ethyl(methoxy)sulfamoyl]phenyl]-N-(5-methoxy-[1,3]thiazolo[5,4-b]pyridin-2-yl)propanamide.
| Compound Name | 3-cyclopentyl-2-[4-[ethyl(methoxy)sulfamoyl]phenyl]-N-(5-methoxy-[1,3]thiazolo[5,4-b]pyridin-2-yl)propanamide |
|---|---|
| PubChem CID | 87236215 |
| Molecular Formula | C24H30N4O5S2 |
| Molecular Weight | 518.66 g/mol |
| Exact Mass | 518.17 |
| IUPAC Name | 3-cyclopentyl-2-[4-[ethyl(methoxy)sulfamoyl]phenyl]-N-(5-methoxy-[1,3]thiazolo[5,4-b]pyridin-2-yl)propanamide |
| SMILES | CCN(OC)S(=O)(=O)c1ccc(C(CC2CCCC2)C(=O)Nc2nc3ccc(OC)nc3s2)cc1 |
| InChI | InChI=1S/C24H30N4O5S2/c1-4-28(33-3)35(30,31)18-11-9-17(10-12-18)19(15-16-7-5-6-8-16)22(29)27-24-25-20-13-14-21(32-2)26-23(20)34-24/h9-14,16,19H,4-8,15H2,1-3H3,(H,25,27,29) |
| InChIKey | ZZMVDVFUHHPNCR-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 110.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.66 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|