C28H29FN4O4S2 — CID 87236348
2-[4-[benzyl(fluoro)sulfamoyl]phenyl]-3-cyclopentyl-N-(5-methoxy-[1,3]thiazolo[5,4-b]pyridin-2-yl)propanamide (PubChem CID 87236348) has the molecular formula C28H29FN4O4S2 and a molecular weight of 568.70 g/mol. Its IUPAC name is 2-[4-[benzyl(fluoro)sulfamoyl]phenyl]-3-cyclopentyl-N-(5-methoxy-[1,3]thiazolo[5,4-b]pyridin-2-yl)propanamide.
| Compound Name | 2-[4-[benzyl(fluoro)sulfamoyl]phenyl]-3-cyclopentyl-N-(5-methoxy-[1,3]thiazolo[5,4-b]pyridin-2-yl)propanamide |
|---|---|
| PubChem CID | 87236348 |
| Molecular Formula | C28H29FN4O4S2 |
| Molecular Weight | 568.70 g/mol |
| Exact Mass | 568.16 |
| IUPAC Name | 2-[4-[benzyl(fluoro)sulfamoyl]phenyl]-3-cyclopentyl-N-(5-methoxy-[1,3]thiazolo[5,4-b]pyridin-2-yl)propanamide |
| SMILES | COc1ccc2nc(NC(=O)C(CC3CCCC3)c3ccc(S(=O)(=O)N(F)Cc4ccccc4)cc3)sc2n1 |
| InChI | InChI=1S/C28H29FN4O4S2/c1-37-25-16-15-24-27(31-25)38-28(30-24)32-26(34)23(17-19-7-5-6-8-19)21-11-13-22(14-12-21)39(35,36)33(29)18-20-9-3-2-4-10-20/h2-4,9-16,19,23H,5-8,17-18H2,1H3,(H,30,32,34) |
| InChIKey | AQNXQTIVUCQBGS-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 101.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.70 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|