C29H34N4O2 — CID 123689498
tert-butyl 4-[4-(1-benzyl-5-cyanoindol-3-yl)but-3-enyl]piperazine-1-carboxylate (PubChem CID 123689498) has the molecular formula C29H34N4O2 and a molecular weight of 470.62 g/mol. Its IUPAC name is tert-butyl 4-[4-(1-benzyl-5-cyanoindol-3-yl)but-3-enyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-(1-benzyl-5-cyanoindol-3-yl)but-3-enyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 123689498 |
| Molecular Formula | C29H34N4O2 |
| Molecular Weight | 470.62 g/mol |
| Exact Mass | 470.27 |
| IUPAC Name | tert-butyl 4-[4-(1-benzyl-5-cyanoindol-3-yl)but-3-enyl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(CCC=Cc2cn(Cc3ccccc3)c3ccc(C#N)cc23)CC1 |
| InChI | InChI=1S/C29H34N4O2/c1-29(2,3)35-28(34)32-17-15-31(16-18-32)14-8-7-11-25-22-33(21-23-9-5-4-6-10-23)27-13-12-24(20-30)19-26(25)27/h4-7,9-13,19,22H,8,14-18,21H2,1-3H3 |
| InChIKey | KSHMKEPZESMTML-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 61.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.62 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |