C20H23N3O4 — CID 171527701
tert-butyl 4-[(E)-4-(3-cyanophenyl)-4-oxobut-2-enoyl]piperazine-1-carboxylate (PubChem CID 171527701) has the molecular formula C20H23N3O4 and a molecular weight of 369.42 g/mol. Its IUPAC name is tert-butyl 4-[(E)-4-(3-cyanophenyl)-4-oxobut-2-enoyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[(E)-4-(3-cyanophenyl)-4-oxobut-2-enoyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 171527701 |
| Molecular Formula | C20H23N3O4 |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.17 |
| IUPAC Name | tert-butyl 4-[(E)-4-(3-cyanophenyl)-4-oxobut-2-enoyl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(C(=O)/C=C/C(=O)c2cccc(C#N)c2)CC1 |
| InChI | InChI=1S/C20H23N3O4/c1-20(2,3)27-19(26)23-11-9-22(10-12-23)18(25)8-7-17(24)16-6-4-5-15(13-16)14-21/h4-8,13H,9-12H2,1-3H3/b8-7+ |
| InChIKey | IRWXHDVKTWSREG-BQYQJAHWSA-N |
| XLogP | 2.38 |
| TPSA | 90.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|