C27H30N4O3 — CID 131746026
tert-butyl 4-[5-[(3-cyanobenzoyl)amino]-1-methylindol-3-yl]piperidine-1-carboxylate (PubChem CID 131746026) has the molecular formula C27H30N4O3 and a molecular weight of 458.56 g/mol. Its IUPAC name is tert-butyl 4-[5-[(3-cyanobenzoyl)amino]-1-methylindol-3-yl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[5-[(3-cyanobenzoyl)amino]-1-methylindol-3-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 131746026 |
| Molecular Formula | C27H30N4O3 |
| Molecular Weight | 458.56 g/mol |
| Exact Mass | 458.23 |
| IUPAC Name | tert-butyl 4-[5-[(3-cyanobenzoyl)amino]-1-methylindol-3-yl]piperidine-1-carboxylate |
| SMILES | Cn1cc(C2CCN(C(=O)OC(C)(C)C)CC2)c2cc(NC(=O)c3cccc(C#N)c3)ccc21 |
| InChI | InChI=1S/C27H30N4O3/c1-27(2,3)34-26(33)31-12-10-19(11-13-31)23-17-30(4)24-9-8-21(15-22(23)24)29-25(32)20-7-5-6-18(14-20)16-28/h5-9,14-15,17,19H,10-13H2,1-4H3,(H,29,32) |
| InChIKey | UDOBODJSQLHDON-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 87.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.56 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |