C22H21N5O3 — CID 118865629
4-[5-[(4-cyanopyridine-2-carbonyl)amino]-1-methylindol-3-yl]piperidine-1-carboxylic acid (PubChem CID 118865629) has the molecular formula C22H21N5O3 and a molecular weight of 403.44 g/mol. Its IUPAC name is 4-[5-[(4-cyanopyridine-2-carbonyl)amino]-1-methylindol-3-yl]piperidine-1-carboxylic acid.
| Compound Name | 4-[5-[(4-cyanopyridine-2-carbonyl)amino]-1-methylindol-3-yl]piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 118865629 |
| Molecular Formula | C22H21N5O3 |
| Molecular Weight | 403.44 g/mol |
| Exact Mass | 403.16 |
| IUPAC Name | 4-[5-[(4-cyanopyridine-2-carbonyl)amino]-1-methylindol-3-yl]piperidine-1-carboxylic acid |
| SMILES | Cn1cc(C2CCN(C(=O)O)CC2)c2cc(NC(=O)c3cc(C#N)ccn3)ccc21 |
| InChI | InChI=1S/C22H21N5O3/c1-26-13-18(15-5-8-27(9-6-15)22(29)30)17-11-16(2-3-20(17)26)25-21(28)19-10-14(12-23)4-7-24-19/h2-4,7,10-11,13,15H,5-6,8-9H2,1H3,(H,25,28)(H,29,30) |
| InChIKey | RLCSXWRBRWMRAA-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 111.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.44 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |