C29H38N4O2 — CID 144782957
4-cyano-N-(3-heptan-4-yl-1-methylindol-5-yl)pyridine-2-carboxamide;2-methylpentan-3-one (PubChem CID 144782957) has the molecular formula C29H38N4O2 and a molecular weight of 474.65 g/mol. Its IUPAC name is 4-cyano-N-(3-heptan-4-yl-1-methylindol-5-yl)pyridine-2-carboxamide;2-methylpentan-3-one.
| Compound Name | 4-cyano-N-(3-heptan-4-yl-1-methylindol-5-yl)pyridine-2-carboxamide;2-methylpentan-3-one |
|---|---|
| PubChem CID | 144782957 |
| Molecular Formula | C29H38N4O2 |
| Molecular Weight | 474.65 g/mol |
| Exact Mass | 474.30 |
| IUPAC Name | 4-cyano-N-(3-heptan-4-yl-1-methylindol-5-yl)pyridine-2-carboxamide;2-methylpentan-3-one |
| SMILES | CCC(=O)C(C)C.CCCC(CCC)c1cn(C)c2ccc(NC(=O)c3cc(C#N)ccn3)cc12 |
| InChI | InChI=1S/C23H26N4O.C6H12O/c1-4-6-17(7-5-2)20-15-27(3)22-9-8-18(13-19(20)22)26-23(28)21-12-16(14-24)10-11-25-21;1-4-6(7)5(2)3/h8-13,15,17H,4-7H2,1-3H3,(H,26,28);5H,4H2,1-3H3 |
| InChIKey | ZZFQJTRLATYECE-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 87.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.65 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |