C25H25F3N5O2+ — CID 123281688
4-cyano-N-[1-methyl-3-[1-methyl-1-(3,3,3-trifluoropropanoyl)piperidin-1-ium-4-yl]indol-5-yl]pyridine-2-carboxamide (PubChem CID 123281688) has the molecular formula C25H25F3N5O2+ and a molecular weight of 484.50 g/mol. Its IUPAC name is 4-cyano-N-[1-methyl-3-[1-methyl-1-(3,3,3-trifluoropropanoyl)piperidin-1-ium-4-yl]indol-5-yl]pyridine-2-carboxamide.
| Compound Name | 4-cyano-N-[1-methyl-3-[1-methyl-1-(3,3,3-trifluoropropanoyl)piperidin-1-ium-4-yl]indol-5-yl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 123281688 |
| Molecular Formula | C25H25F3N5O2+ |
| Molecular Weight | 484.50 g/mol |
| Exact Mass | 484.20 |
| IUPAC Name | 4-cyano-N-[1-methyl-3-[1-methyl-1-(3,3,3-trifluoropropanoyl)piperidin-1-ium-4-yl]indol-5-yl]pyridine-2-carboxamide |
| SMILES | Cn1cc(C2CC[N+](C)(C(=O)CC(F)(F)F)CC2)c2cc(NC(=O)c3cc(C#N)ccn3)ccc21 |
| InChI | InChI=1S/C25H24F3N5O2/c1-32-15-20(17-6-9-33(2,10-7-17)23(34)13-25(26,27)28)19-12-18(3-4-22(19)32)31-24(35)21-11-16(14-29)5-8-30-21/h3-5,8,11-12,15,17H,6-7,9-10,13H2,1-2H3/p+1 |
| InChIKey | WGYKVBBWOQQTMH-UHFFFAOYSA-O |
| XLogP | 4.50 |
| TPSA | 87.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.50 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|