C23H23N5O2 — CID 137414218
4-cyano-N-[1-ethyl-3-(1-formylpiperidin-4-yl)indol-5-yl]pyridine-2-carboxamide (PubChem CID 137414218) has the molecular formula C23H23N5O2 and a molecular weight of 401.47 g/mol. Its IUPAC name is 4-cyano-N-[1-ethyl-3-(1-formylpiperidin-4-yl)indol-5-yl]pyridine-2-carboxamide.
| Compound Name | 4-cyano-N-[1-ethyl-3-(1-formylpiperidin-4-yl)indol-5-yl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 137414218 |
| Molecular Formula | C23H23N5O2 |
| Molecular Weight | 401.47 g/mol |
| Exact Mass | 401.19 |
| IUPAC Name | 4-cyano-N-[1-ethyl-3-(1-formylpiperidin-4-yl)indol-5-yl]pyridine-2-carboxamide |
| SMILES | CCn1cc(C2CCN(C=O)CC2)c2cc(NC(=O)c3cc(C#N)ccn3)ccc21 |
| InChI | InChI=1S/C23H23N5O2/c1-2-28-14-20(17-6-9-27(15-29)10-7-17)19-12-18(3-4-22(19)28)26-23(30)21-11-16(13-24)5-8-25-21/h3-5,8,11-12,14-15,17H,2,6-7,9-10H2,1H3,(H,26,30) |
| InChIKey | ZKXNSUWLIDBNKT-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 91.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.47 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|