C19H21F2N3O2 — CID 135235029
N-[3-[1-(2,2-difluorocyclopropanecarbonyl)piperidin-4-yl]-1-methylindol-5-yl]formamide (PubChem CID 135235029) has the molecular formula C19H21F2N3O2 and a molecular weight of 361.39 g/mol. Its IUPAC name is N-[3-[1-(2,2-difluorocyclopropanecarbonyl)piperidin-4-yl]-1-methylindol-5-yl]formamide.
| Compound Name | N-[3-[1-(2,2-difluorocyclopropanecarbonyl)piperidin-4-yl]-1-methylindol-5-yl]formamide |
|---|---|
| PubChem CID | 135235029 |
| Molecular Formula | C19H21F2N3O2 |
| Molecular Weight | 361.39 g/mol |
| Exact Mass | 361.16 |
| IUPAC Name | N-[3-[1-(2,2-difluorocyclopropanecarbonyl)piperidin-4-yl]-1-methylindol-5-yl]formamide |
| SMILES | Cn1cc(C2CCN(C(=O)C3CC3(F)F)CC2)c2cc(NC=O)ccc21 |
| InChI | InChI=1S/C19H21F2N3O2/c1-23-10-15(14-8-13(22-11-25)2-3-17(14)23)12-4-6-24(7-5-12)18(26)16-9-19(16,20)21/h2-3,8,10-12,16H,4-7,9H2,1H3,(H,22,25) |
| InChIKey | LNFMMGQLGZXHHS-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 54.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.39 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|