C26H31N3OS — CID 135234993
cyclopentyl-[4-[1-methyl-5-(phenylsulfanylamino)indol-3-yl]piperidin-1-yl]methanone (PubChem CID 135234993) has the molecular formula C26H31N3OS and a molecular weight of 433.62 g/mol. Its IUPAC name is cyclopentyl-[4-[1-methyl-5-(phenylsulfanylamino)indol-3-yl]piperidin-1-yl]methanone.
| Compound Name | cyclopentyl-[4-[1-methyl-5-(phenylsulfanylamino)indol-3-yl]piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 135234993 |
| Molecular Formula | C26H31N3OS |
| Molecular Weight | 433.62 g/mol |
| Exact Mass | 433.22 |
| IUPAC Name | cyclopentyl-[4-[1-methyl-5-(phenylsulfanylamino)indol-3-yl]piperidin-1-yl]methanone |
| SMILES | Cn1cc(C2CCN(C(=O)C3CCCC3)CC2)c2cc(NSc3ccccc3)ccc21 |
| InChI | InChI=1S/C26H31N3OS/c1-28-18-24(19-13-15-29(16-14-19)26(30)20-7-5-6-8-20)23-17-21(11-12-25(23)28)27-31-22-9-3-2-4-10-22/h2-4,9-12,17-20,27H,5-8,13-16H2,1H3 |
| InChIKey | OQFZYPAYHCWNCE-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 37.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.62 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|