C27H32N2O3S — CID 149106216
[4-[5-(benzenesulfonylmethyl)-1-methylindol-3-yl]piperidin-1-yl]-cyclopentylmethanone (PubChem CID 149106216) has the molecular formula C27H32N2O3S and a molecular weight of 464.63 g/mol. Its IUPAC name is [4-[5-(benzenesulfonylmethyl)-1-methylindol-3-yl]piperidin-1-yl]-cyclopentylmethanone.
| Compound Name | [4-[5-(benzenesulfonylmethyl)-1-methylindol-3-yl]piperidin-1-yl]-cyclopentylmethanone |
|---|---|
| PubChem CID | 149106216 |
| Molecular Formula | C27H32N2O3S |
| Molecular Weight | 464.63 g/mol |
| Exact Mass | 464.21 |
| IUPAC Name | [4-[5-(benzenesulfonylmethyl)-1-methylindol-3-yl]piperidin-1-yl]-cyclopentylmethanone |
| SMILES | Cn1cc(C2CCN(C(=O)C3CCCC3)CC2)c2cc(CS(=O)(=O)c3ccccc3)ccc21 |
| InChI | InChI=1S/C27H32N2O3S/c1-28-18-25(21-13-15-29(16-14-21)27(30)22-7-5-6-8-22)24-17-20(11-12-26(24)28)19-33(31,32)23-9-3-2-4-10-23/h2-4,9-12,17-18,21-22H,5-8,13-16,19H2,1H3 |
| InChIKey | QVSHTPBHDBXXCM-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 59.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.63 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |