C24H28N4O4 — CID 130451221
tert-butyl 4-[[3-[(3-cyanobenzoyl)amino]-2-hydroxyphenyl]methyl]piperazine-1-carboxylate (PubChem CID 130451221) has the molecular formula C24H28N4O4 and a molecular weight of 436.51 g/mol. Its IUPAC name is tert-butyl 4-[[3-[(3-cyanobenzoyl)amino]-2-hydroxyphenyl]methyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[[3-[(3-cyanobenzoyl)amino]-2-hydroxyphenyl]methyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 130451221 |
| Molecular Formula | C24H28N4O4 |
| Molecular Weight | 436.51 g/mol |
| Exact Mass | 436.21 |
| IUPAC Name | tert-butyl 4-[[3-[(3-cyanobenzoyl)amino]-2-hydroxyphenyl]methyl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(Cc2cccc(NC(=O)c3cccc(C#N)c3)c2O)CC1 |
| InChI | InChI=1S/C24H28N4O4/c1-24(2,3)32-23(31)28-12-10-27(11-13-28)16-19-8-5-9-20(21(19)29)26-22(30)18-7-4-6-17(14-18)15-25/h4-9,14,29H,10-13,16H2,1-3H3,(H,26,30) |
| InChIKey | LHVSMSLQJGEOTL-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 105.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.51 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|