C31H41IN2O6 — CID 123689676
ethyl (3R,5S,8S)-8-tert-butyl-21-iodo-13,13-dimethyl-7,10-dioxo-2,11-dioxa-6,23-diazatetracyclo[15.6.2.13,6.020,24]hexacosa-1(23),17(25),18,20(24),21-pentaene-5-carboxylate (PubChem CID 123689676) has the molecular formula C31H41IN2O6 and a molecular weight of 664.58 g/mol. Its IUPAC name is ethyl (3R,5S,8S)-8-tert-butyl-21-iodo-13,13-dimethyl-7,10-dioxo-2,11-dioxa-6,23-diazatetracyclo[15.6.2.13,6.020,24]hexacosa-1(23),17(25),18,20(24),21-pentaene-5-carboxylate.
| Compound Name | ethyl (3R,5S,8S)-8-tert-butyl-21-iodo-13,13-dimethyl-7,10-dioxo-2,11-dioxa-6,23-diazatetracyclo[15.6.2.13,6.020,24]hexacosa-1(23),17(25),18,20(24),21-pentaene-5-carboxylate |
|---|---|
| PubChem CID | 123689676 |
| Molecular Formula | C31H41IN2O6 |
| Molecular Weight | 664.58 g/mol |
| Exact Mass | 664.20 |
| IUPAC Name | ethyl (3R,5S,8S)-8-tert-butyl-21-iodo-13,13-dimethyl-7,10-dioxo-2,11-dioxa-6,23-diazatetracyclo[15.6.2.13,6.020,24]hexacosa-1(23),17(25),18,20(24),21-pentaene-5-carboxylate |
| SMILES | CCOC(=O)[C@@H]1C[C@@H]2CN1C(=O)[C@H](C(C)(C)C)CC(=O)OCC(C)(C)CCCc1ccc3c(I)cnc(c3c1)O2 |
| InChI | InChI=1S/C31H41IN2O6/c1-7-38-29(37)25-14-20-17-34(25)28(36)23(30(2,3)4)15-26(35)39-18-31(5,6)12-8-9-19-10-11-21-22(13-19)27(40-20)33-16-24(21)32/h10-11,13,16,20,23,25H,7-9,12,14-15,17-18H2,1-6H3/t20-,23-,25+/m1/s1 |
| InChIKey | IDCQBNVKSTYGHZ-XRODADMRSA-N |
| XLogP | 5.71 |
| TPSA | 95.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.58 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|