About 3-(2-methoxypropan-2-ylsilyl)propyl 3-oxobutanoate
3-(2-methoxypropan-2-ylsilyl)propyl 3-oxobutanoate (PubChem CID 123690492) has the molecular formula C11H22O4Si
and a molecular weight of 246.38 g/mol. Its IUPAC name is 3-(2-methoxypropan-2-ylsilyl)propyl 3-oxobutanoate.
Molecular Properties
| Compound Name | 3-(2-methoxypropan-2-ylsilyl)propyl 3-oxobutanoate |
| PubChem CID | 123690492 |
| Molecular Formula | C11H22O4Si |
| Molecular Weight | 246.38 g/mol |
| Exact Mass | 246.13 |
| IUPAC Name | 3-(2-methoxypropan-2-ylsilyl)propyl 3-oxobutanoate |
| SMILES | COC(C)(C)[SiH2]CCCOC(=O)CC(C)=O |
| InChI | InChI=1S/C11H22O4Si/c1-9(12)8-10(13)15-6-5-7-16-11(2,3)14-4/h5-8,16H2,1-4H3 |
| InChIKey | UPUHUGFSQQEZGV-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.38 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 3-(2-methoxypropan-2-ylsilyl)propyl 3-oxobutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-methoxypropan-2-ylsilyl)propyl 3-oxobutanoate?
The IUPAC name of 3-(2-methoxypropan-2-ylsilyl)propyl 3-oxobutanoate (CID 123690492) is 3-(2-methoxypropan-2-ylsilyl)propyl 3-oxobutanoate.
What is the SMILES notation for 3-(2-methoxypropan-2-ylsilyl)propyl 3-oxobutanoate?
The canonical SMILES for 3-(2-methoxypropan-2-ylsilyl)propyl 3-oxobutanoate is COC(C)(C)[SiH2]CCCOC(=O)CC(C)=O.
What is the InChIKey of 3-(2-methoxypropan-2-ylsilyl)propyl 3-oxobutanoate?
The InChIKey is UPUHUGFSQQEZGV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22O4Si/c1-9(12)8-10(13)15-6-5-7-16-11(2,3)14-4/h5-8,16H2,1-4H3.
What are the key properties of 3-(2-methoxypropan-2-ylsilyl)propyl 3-oxobutanoate?
3-(2-methoxypropan-2-ylsilyl)propyl 3-oxobutanoate has a molecular weight of 246.38 g/mol, XLogP of 0.87, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-methoxypropan-2-ylsilyl)propyl 3-oxobutanoate is sourced from PubChem (CID 123690492), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).