C15H23N — CID 123690866
1-(3,7-diethyl-2-bicyclo[3.3.1]nona-2,6-dienyl)ethanimine (PubChem CID 123690866) has the molecular formula C15H23N and a molecular weight of 217.36 g/mol. Its IUPAC name is 1-(3,7-diethyl-2-bicyclo[3.3.1]nona-2,6-dienyl)ethanimine.
| Compound Name | 1-(3,7-diethyl-2-bicyclo[3.3.1]nona-2,6-dienyl)ethanimine |
|---|---|
| PubChem CID | 123690866 |
| Molecular Formula | C15H23N |
| Molecular Weight | 217.36 g/mol |
| Exact Mass | 217.18 |
| IUPAC Name | 1-(3,7-diethyl-2-bicyclo[3.3.1]nona-2,6-dienyl)ethanimine |
| SMILES | [H]/N=C(\C)C1=C(CC)CC2C=C(CC)CC1C2 |
| InChI | InChI=1S/C15H23N/c1-4-11-6-12-8-13(5-2)15(10(3)16)14(7-11)9-12/h6,12,14,16H,4-5,7-9H2,1-3H3/b16-10+ |
| InChIKey | FKXUHDHJXVLXDJ-MHWRWJLKSA-N |
| XLogP | 4.50 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.36 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|