C17H13N5O — CID 123691266
2-[2-[(5-methoxy-2-pyridinyl)amino]pyrimidin-4-yl]benzonitrile (PubChem CID 123691266) has the molecular formula C17H13N5O and a molecular weight of 303.33 g/mol. Its IUPAC name is 2-[2-[(5-methoxy-2-pyridinyl)amino]pyrimidin-4-yl]benzonitrile.
| Compound Name | 2-[2-[(5-methoxy-2-pyridinyl)amino]pyrimidin-4-yl]benzonitrile |
|---|---|
| PubChem CID | 123691266 |
| Molecular Formula | C17H13N5O |
| Molecular Weight | 303.33 g/mol |
| Exact Mass | 303.11 |
| IUPAC Name | 2-[2-[(5-methoxy-2-pyridinyl)amino]pyrimidin-4-yl]benzonitrile |
| SMILES | COc1ccc(Nc2nccc(-c3ccccc3C#N)n2)nc1 |
| InChI | InChI=1S/C17H13N5O/c1-23-13-6-7-16(20-11-13)22-17-19-9-8-15(21-17)14-5-3-2-4-12(14)10-18/h2-9,11H,1H3,(H,19,20,21,22) |
| InChIKey | MPYFOYMVLFVDCY-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 83.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.33 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |