C23H24BrClN4O3 — CID 123692632
ethyl 4-[5-(4-bromophenyl)-6-chloro-1-prop-2-enylimidazo[4,5-b]pyridin-2-yl]oxypiperidine-1-carboxylate (PubChem CID 123692632) has the molecular formula C23H24BrClN4O3 and a molecular weight of 519.83 g/mol. Its IUPAC name is ethyl 4-[5-(4-bromophenyl)-6-chloro-1-prop-2-enylimidazo[4,5-b]pyridin-2-yl]oxypiperidine-1-carboxylate.
| Compound Name | ethyl 4-[5-(4-bromophenyl)-6-chloro-1-prop-2-enylimidazo[4,5-b]pyridin-2-yl]oxypiperidine-1-carboxylate |
|---|---|
| PubChem CID | 123692632 |
| Molecular Formula | C23H24BrClN4O3 |
| Molecular Weight | 519.83 g/mol |
| Exact Mass | 518.07 |
| IUPAC Name | ethyl 4-[5-(4-bromophenyl)-6-chloro-1-prop-2-enylimidazo[4,5-b]pyridin-2-yl]oxypiperidine-1-carboxylate |
| SMILES | C=CCn1c(OC2CCN(C(=O)OCC)CC2)nc2nc(-c3ccc(Br)cc3)c(Cl)cc21 |
| InChI | InChI=1S/C23H24BrClN4O3/c1-3-11-29-19-14-18(25)20(15-5-7-16(24)8-6-15)26-21(19)27-22(29)32-17-9-12-28(13-10-17)23(30)31-4-2/h3,5-8,14,17H,1,4,9-13H2,2H3 |
| InChIKey | IWCFUALRFYMIIB-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 69.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.83 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|