C15H30 — CID 123693329
1,2,4-triethyl-3-methyl-5-propan-2-ylcyclopentane (PubChem CID 123693329) has the molecular formula C15H30 and a molecular weight of 210.40 g/mol. Its IUPAC name is 1,2,4-triethyl-3-methyl-5-propan-2-ylcyclopentane.
| Compound Name | 1,2,4-triethyl-3-methyl-5-propan-2-ylcyclopentane |
|---|---|
| PubChem CID | 123693329 |
| Molecular Formula | C15H30 |
| Molecular Weight | 210.40 g/mol |
| Exact Mass | 210.23 |
| IUPAC Name | 1,2,4-triethyl-3-methyl-5-propan-2-ylcyclopentane |
| SMILES | CCC1C(C)C(CC)C(C(C)C)C1CC |
| InChI | InChI=1S/C15H30/c1-7-12-11(6)13(8-2)15(10(4)5)14(12)9-3/h10-15H,7-9H2,1-6H3 |
| InChIKey | ITOOVNDUGKDPFJ-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.40 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |