C21H26N6O — CID 123696799
2-(1,3-diimino-1-phenylpropan-2-yl)-7-ethyl-5-methyl-8-propan-2-yl-7H-pteridin-6-one (PubChem CID 123696799) has the molecular formula C21H26N6O and a molecular weight of 378.48 g/mol. Its IUPAC name is 2-(1,3-diimino-1-phenylpropan-2-yl)-7-ethyl-5-methyl-8-propan-2-yl-7H-pteridin-6-one.
| Compound Name | 2-(1,3-diimino-1-phenylpropan-2-yl)-7-ethyl-5-methyl-8-propan-2-yl-7H-pteridin-6-one |
|---|---|
| PubChem CID | 123696799 |
| Molecular Formula | C21H26N6O |
| Molecular Weight | 378.48 g/mol |
| Exact Mass | 378.22 |
| IUPAC Name | 2-(1,3-diimino-1-phenylpropan-2-yl)-7-ethyl-5-methyl-8-propan-2-yl-7H-pteridin-6-one |
| SMILES | [H]/N=C(\c1ccccc1)C(/C=N/[H])c1ncc2c(n1)N(C(C)C)C(CC)C(=O)N2C |
| InChI | InChI=1S/C21H26N6O/c1-5-16-21(28)26(4)17-12-24-19(25-20(17)27(16)13(2)3)15(11-22)18(23)14-9-7-6-8-10-14/h6-13,15-16,22-23H,5H2,1-4H3/b22-11+,23-18+ |
| InChIKey | OIFVTCIJGYHDFE-ZKNHDNAPSA-N |
| XLogP | 3.25 |
| TPSA | 97.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.48 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|