C21H23ClFN5O — CID 123697201
1-[3-chloro-5-[4-(1-imino-3-methyliminopropan-2-yl)phenyl]-4-pyridinyl]-4-fluoropiperidine-4-carboxamide (PubChem CID 123697201) has the molecular formula C21H23ClFN5O and a molecular weight of 415.90 g/mol. Its IUPAC name is 1-[3-chloro-5-[4-(1-imino-3-methyliminopropan-2-yl)phenyl]-4-pyridinyl]-4-fluoropiperidine-4-carboxamide.
| Compound Name | 1-[3-chloro-5-[4-(1-imino-3-methyliminopropan-2-yl)phenyl]-4-pyridinyl]-4-fluoropiperidine-4-carboxamide |
|---|---|
| PubChem CID | 123697201 |
| Molecular Formula | C21H23ClFN5O |
| Molecular Weight | 415.90 g/mol |
| Exact Mass | 415.16 |
| IUPAC Name | 1-[3-chloro-5-[4-(1-imino-3-methyliminopropan-2-yl)phenyl]-4-pyridinyl]-4-fluoropiperidine-4-carboxamide |
| SMILES | [H]/N=C/C(/C=N/C)c1ccc(-c2cncc(Cl)c2N2CCC(F)(C(N)=O)CC2)cc1 |
| InChI | InChI=1S/C21H23ClFN5O/c1-26-11-16(10-24)14-2-4-15(5-3-14)17-12-27-13-18(22)19(17)28-8-6-21(23,7-9-28)20(25)29/h2-5,10-13,16,24H,6-9H2,1H3,(H2,25,29)/b24-10+,26-11+ |
| InChIKey | FTRHOSBYYMRHAO-KNFBYZCCSA-N |
| XLogP | 3.63 |
| TPSA | 95.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.90 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|