About 3,4-dimethylhexan-3-yl 2-ethyl-2,3,3-trimethylbutanoate
3,4-dimethylhexan-3-yl 2-ethyl-2,3,3-trimethylbutanoate (PubChem CID 123699333) has the molecular formula C17H34O2
and a molecular weight of 270.46 g/mol. Its IUPAC name is 3,4-dimethylhexan-3-yl 2-ethyl-2,3,3-trimethylbutanoate.
Analyze 3,4-dimethylhexan-3-yl 2-ethyl-2,3,3-trimethylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-dimethylhexan-3-yl 2-ethyl-2,3,3-trimethylbutanoate?
The IUPAC name of 3,4-dimethylhexan-3-yl 2-ethyl-2,3,3-trimethylbutanoate (CID 123699333) is 3,4-dimethylhexan-3-yl 2-ethyl-2,3,3-trimethylbutanoate.
What is the SMILES notation for 3,4-dimethylhexan-3-yl 2-ethyl-2,3,3-trimethylbutanoate?
The canonical SMILES for 3,4-dimethylhexan-3-yl 2-ethyl-2,3,3-trimethylbutanoate is CCC(C)C(C)(CC)OC(=O)C(C)(CC)C(C)(C)C.
What is the InChIKey of 3,4-dimethylhexan-3-yl 2-ethyl-2,3,3-trimethylbutanoate?
The InChIKey is FTOIVXJNQMQYQQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H34O2/c1-10-13(4)17(9,12-3)19-14(18)16(8,11-2)15(5,6)7/h13H,10-12H2,1-9H3.
What are the key properties of 3,4-dimethylhexan-3-yl 2-ethyl-2,3,3-trimethylbutanoate?
3,4-dimethylhexan-3-yl 2-ethyl-2,3,3-trimethylbutanoate has a molecular weight of 270.46 g/mol, XLogP of 5.21, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dimethylhexan-3-yl 2-ethyl-2,3,3-trimethylbutanoate is sourced from PubChem (CID 123699333), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).