C32H51NO4 — CID 123699643
[10,13,14-trimethyl-17-(6-methylheptan-2-yl)-1,2,3,4,7,8,9,11,12,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-yl] 2-(hydroxycarbamoyl)prop-2-enoate (PubChem CID 123699643) has the molecular formula C32H51NO4 and a molecular weight of 513.76 g/mol. Its IUPAC name is [10,13,14-trimethyl-17-(6-methylheptan-2-yl)-1,2,3,4,7,8,9,11,12,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-yl] 2-(hydroxycarbamoyl)prop-2-enoate.
| Compound Name | [10,13,14-trimethyl-17-(6-methylheptan-2-yl)-1,2,3,4,7,8,9,11,12,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-yl] 2-(hydroxycarbamoyl)prop-2-enoate |
|---|---|
| PubChem CID | 123699643 |
| Molecular Formula | C32H51NO4 |
| Molecular Weight | 513.76 g/mol |
| Exact Mass | 513.38 |
| IUPAC Name | [10,13,14-trimethyl-17-(6-methylheptan-2-yl)-1,2,3,4,7,8,9,11,12,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-yl] 2-(hydroxycarbamoyl)prop-2-enoate |
| SMILES | C=C(C(=O)NO)C(=O)OC1CCC2(C)C(=CCC3C2CCC2(C)C(C(C)CCCC(C)C)CCC32C)C1 |
| InChI | InChI=1S/C32H51NO4/c1-20(2)9-8-10-21(3)25-14-17-32(7)27-12-11-23-19-24(37-29(35)22(4)28(34)33-36)13-16-30(23,5)26(27)15-18-31(25,32)6/h11,20-21,24-27,36H,4,8-10,12-19H2,1-3,5-7H3,(H,33,34) |
| InChIKey | JMSFAJQPIIAWHC-UHFFFAOYSA-N |
| XLogP | 7.39 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.76 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|