C35H61NO3 — CID 163737091
ethyl 2-[methyl-[2-[[(3S,8R,9S,13R,14S,17R)-10,13,14-trimethyl-17-[(2R)-6-methylheptan-2-yl]-1,2,3,4,7,8,9,11,12,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-yl]oxy]ethyl]amino]acetate (PubChem CID 163737091) has the molecular formula C35H61NO3 and a molecular weight of 543.88 g/mol. Its IUPAC name is ethyl 2-[methyl-[2-[[(3S,8R,9S,13R,14S,17R)-10,13,14-trimethyl-17-[(2R)-6-methylheptan-2-yl]-1,2,3,4,7,8,9,11,12,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-yl]oxy]ethyl]amino]acetate.
| Compound Name | ethyl 2-[methyl-[2-[[(3S,8R,9S,13R,14S,17R)-10,13,14-trimethyl-17-[(2R)-6-methylheptan-2-yl]-1,2,3,4,7,8,9,11,12,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-yl]oxy]ethyl]amino]acetate |
|---|---|
| PubChem CID | 163737091 |
| Molecular Formula | C35H61NO3 |
| Molecular Weight | 543.88 g/mol |
| Exact Mass | 543.47 |
| IUPAC Name | ethyl 2-[methyl-[2-[[(3S,8R,9S,13R,14S,17R)-10,13,14-trimethyl-17-[(2R)-6-methylheptan-2-yl]-1,2,3,4,7,8,9,11,12,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-yl]oxy]ethyl]amino]acetate |
| SMILES | CCOC(=O)CN(C)CCO[C@H]1CCC2(C)C(=CC[C@@H]3[C@@H]2CC[C@]2(C)[C@@H]([C@H](C)CCCC(C)C)CC[C@@]32C)C1 |
| InChI | InChI=1S/C35H61NO3/c1-9-38-32(37)24-36(8)21-22-39-28-15-18-33(5)27(23-28)13-14-31-30(33)17-20-34(6)29(16-19-35(31,34)7)26(4)12-10-11-25(2)3/h13,25-26,28-31H,9-12,14-24H2,1-8H3/t26-,28+,29-,30+,31-,33?,34-,35+/m1/s1 |
| InChIKey | LEOHPJCQQVNIAQ-BZDSFSROSA-N |
| XLogP | 8.30 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.88 |
| LogP ≤ 5 | 8.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|