C34H36F4O12S2 — CID 123700750
2-[[3-(4-ethenylbenzoyl)oxy-1-adamantyl]methoxy]-1,1-difluoro-2-oxoethanesulfonic acid;2-(4-ethenylbenzoyl)oxy-1,1-difluoropropane-1-sulfonic acid (PubChem CID 123700750) has the molecular formula C34H36F4O12S2 and a molecular weight of 776.78 g/mol. Its IUPAC name is 2-[[3-(4-ethenylbenzoyl)oxy-1-adamantyl]methoxy]-1,1-difluoro-2-oxoethanesulfonic acid;2-(4-ethenylbenzoyl)oxy-1,1-difluoropropane-1-sulfonic acid.
| Compound Name | 2-[[3-(4-ethenylbenzoyl)oxy-1-adamantyl]methoxy]-1,1-difluoro-2-oxoethanesulfonic acid;2-(4-ethenylbenzoyl)oxy-1,1-difluoropropane-1-sulfonic acid |
|---|---|
| PubChem CID | 123700750 |
| Molecular Formula | C34H36F4O12S2 |
| Molecular Weight | 776.78 g/mol |
| Exact Mass | 776.16 |
| IUPAC Name | 2-[[3-(4-ethenylbenzoyl)oxy-1-adamantyl]methoxy]-1,1-difluoro-2-oxoethanesulfonic acid;2-(4-ethenylbenzoyl)oxy-1,1-difluoropropane-1-sulfonic acid |
| SMILES | C=Cc1ccc(C(=O)OC(C)C(F)(F)S(=O)(=O)O)cc1.C=Cc1ccc(C(=O)OC23CC4CC(CC(COC(=O)C(F)(F)S(=O)(=O)O)(C4)C2)C3)cc1 |
| InChI | InChI=1S/C22H24F2O7S.C12H12F2O5S/c1-2-14-3-5-17(6-4-14)18(25)31-21-10-15-7-16(11-21)9-20(8-15,12-21)13-30-19(26)22(23,24)32(27,28)29;1-3-9-4-6-10(7-5-9)11(15)19-8(2)12(13,14)20(16,17)18/h2-6,15-16H,1,7-13H2,(H,27,28,29);3-8H,1H2,2H3,(H,16,17,18) |
| InChIKey | CZEYFTRWDJVFFA-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 187.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 776.78 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|