C16H11F5O5S — CID 23149372
1,1,3,3,3-pentafluoro-2-(4-phenylbenzoyl)oxypropane-1-sulfonic acid (PubChem CID 23149372) has the molecular formula C16H11F5O5S and a molecular weight of 410.32 g/mol. Its IUPAC name is 1,1,3,3,3-pentafluoro-2-(4-phenylbenzoyl)oxypropane-1-sulfonic acid.
| Compound Name | 1,1,3,3,3-pentafluoro-2-(4-phenylbenzoyl)oxypropane-1-sulfonic acid |
|---|---|
| PubChem CID | 23149372 |
| Molecular Formula | C16H11F5O5S |
| Molecular Weight | 410.32 g/mol |
| Exact Mass | 410.02 |
| IUPAC Name | 1,1,3,3,3-pentafluoro-2-(4-phenylbenzoyl)oxypropane-1-sulfonic acid |
| SMILES | O=C(OC(C(F)(F)F)C(F)(F)S(=O)(=O)O)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C16H11F5O5S/c17-15(18,19)14(16(20,21)27(23,24)25)26-13(22)12-8-6-11(7-9-12)10-4-2-1-3-5-10/h1-9,14H,(H,23,24,25) |
| InChIKey | OLGRZRDHJXECNV-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.32 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|