C27H38N2O7 — CID 123700811
(2,5-dihydroxypyrrol-1-yl) 2-[[2-[(17-hydroxy-10,13-dimethyl-2,3,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl)oxy]acetyl]amino]acetate (PubChem CID 123700811) has the molecular formula C27H38N2O7 and a molecular weight of 502.61 g/mol. Its IUPAC name is (2,5-dihydroxypyrrol-1-yl) 2-[[2-[(17-hydroxy-10,13-dimethyl-2,3,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl)oxy]acetyl]amino]acetate.
| Compound Name | (2,5-dihydroxypyrrol-1-yl) 2-[[2-[(17-hydroxy-10,13-dimethyl-2,3,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl)oxy]acetyl]amino]acetate |
|---|---|
| PubChem CID | 123700811 |
| Molecular Formula | C27H38N2O7 |
| Molecular Weight | 502.61 g/mol |
| Exact Mass | 502.27 |
| IUPAC Name | (2,5-dihydroxypyrrol-1-yl) 2-[[2-[(17-hydroxy-10,13-dimethyl-2,3,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl)oxy]acetyl]amino]acetate |
| SMILES | CC12CCC(OCC(=O)NCC(=O)On3c(O)ccc3O)C=C1CCC1C2CCC2(C)C(O)CCC12 |
| InChI | InChI=1S/C27H38N2O7/c1-26-11-9-17(35-15-22(31)28-14-25(34)36-29-23(32)7-8-24(29)33)13-16(26)3-4-18-19-5-6-21(30)27(19,2)12-10-20(18)26/h7-8,13,17-21,30,32-33H,3-6,9-12,14-15H2,1-2H3,(H,28,31) |
| InChIKey | OAWKYESTEFXEQU-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 130.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.61 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|