C6H9N3O2 — CID 123706108
3-methyl-6-oxo-2,3-dihydro-1H-pyrazine-5-carboxamide (PubChem CID 123706108) has the molecular formula C6H9N3O2 and a molecular weight of 155.16 g/mol. Its IUPAC name is 3-methyl-6-oxo-2,3-dihydro-1H-pyrazine-5-carboxamide.
| Compound Name | 3-methyl-6-oxo-2,3-dihydro-1H-pyrazine-5-carboxamide |
|---|---|
| PubChem CID | 123706108 |
| Molecular Formula | C6H9N3O2 |
| Molecular Weight | 155.16 g/mol |
| Exact Mass | 155.07 |
| IUPAC Name | 3-methyl-6-oxo-2,3-dihydro-1H-pyrazine-5-carboxamide |
| SMILES | CC1CNC(=O)C(C(N)=O)=N1 |
| InChI | InChI=1S/C6H9N3O2/c1-3-2-8-6(11)4(9-3)5(7)10/h3H,2H2,1H3,(H2,7,10)(H,8,11) |
| InChIKey | IKDRQUNAURXTIK-UHFFFAOYSA-N |
| XLogP | -1.57 |
| TPSA | 84.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.16 |
| LogP ≤ 5 | -1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |