C5H9N3O — CID 45092769
(5S)-3-amino-5-methyl-2,5-dihydro-1H-pyrazin-6-one (PubChem CID 45092769) has the molecular formula C5H9N3O and a molecular weight of 127.15 g/mol. Its IUPAC name is (5S)-3-amino-5-methyl-2,5-dihydro-1H-pyrazin-6-one.
| Compound Name | (5S)-3-amino-5-methyl-2,5-dihydro-1H-pyrazin-6-one |
|---|---|
| PubChem CID | 45092769 |
| Molecular Formula | C5H9N3O |
| Molecular Weight | 127.15 g/mol |
| Exact Mass | 127.07 |
| IUPAC Name | (5S)-3-amino-5-methyl-2,5-dihydro-1H-pyrazin-6-one |
| SMILES | C[C@@H]1N=C(N)CNC1=O |
| InChI | InChI=1S/C5H9N3O/c1-3-5(9)7-2-4(6)8-3/h3H,2H2,1H3,(H2,6,8)(H,7,9)/t3-/m0/s1 |
| InChIKey | BRTYIALMRMZGTC-VKHMYHEASA-N |
| XLogP | -1.14 |
| TPSA | 67.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 127.15 |
| LogP ≤ 5 | -1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |