C11H18F5NO3S — CID 123707228
3-[2-(4,4,5,5,5-pentafluoropentylsulfonyl)ethyl]morpholine (PubChem CID 123707228) has the molecular formula C11H18F5NO3S and a molecular weight of 339.33 g/mol. Its IUPAC name is 3-[2-(4,4,5,5,5-pentafluoropentylsulfonyl)ethyl]morpholine.
| Compound Name | 3-[2-(4,4,5,5,5-pentafluoropentylsulfonyl)ethyl]morpholine |
|---|---|
| PubChem CID | 123707228 |
| Molecular Formula | C11H18F5NO3S |
| Molecular Weight | 339.33 g/mol |
| Exact Mass | 339.09 |
| IUPAC Name | 3-[2-(4,4,5,5,5-pentafluoropentylsulfonyl)ethyl]morpholine |
| SMILES | O=S(=O)(CCCC(F)(F)C(F)(F)F)CCC1COCCN1 |
| InChI | InChI=1S/C11H18F5NO3S/c12-10(13,11(14,15)16)3-1-6-21(18,19)7-2-9-8-20-5-4-17-9/h9,17H,1-8H2 |
| InChIKey | FCCVREXIHYPBKN-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.33 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|