C24H29N5O3 — CID 123707604
4-[3-[amino(hydroxy)methyl]phenyl]-N-[1-(2-methoxyphenyl)piperidin-4-yl]-N-methylimidazole-1-carboxamide (PubChem CID 123707604) has the molecular formula C24H29N5O3 and a molecular weight of 435.53 g/mol. Its IUPAC name is 4-[3-[amino(hydroxy)methyl]phenyl]-N-[1-(2-methoxyphenyl)piperidin-4-yl]-N-methylimidazole-1-carboxamide.
| Compound Name | 4-[3-[amino(hydroxy)methyl]phenyl]-N-[1-(2-methoxyphenyl)piperidin-4-yl]-N-methylimidazole-1-carboxamide |
|---|---|
| PubChem CID | 123707604 |
| Molecular Formula | C24H29N5O3 |
| Molecular Weight | 435.53 g/mol |
| Exact Mass | 435.23 |
| IUPAC Name | 4-[3-[amino(hydroxy)methyl]phenyl]-N-[1-(2-methoxyphenyl)piperidin-4-yl]-N-methylimidazole-1-carboxamide |
| SMILES | COc1ccccc1N1CCC(N(C)C(=O)n2cnc(-c3cccc(C(N)O)c3)c2)CC1 |
| InChI | InChI=1S/C24H29N5O3/c1-27(19-10-12-28(13-11-19)21-8-3-4-9-22(21)32-2)24(31)29-15-20(26-16-29)17-6-5-7-18(14-17)23(25)30/h3-9,14-16,19,23,30H,10-13,25H2,1-2H3 |
| InChIKey | HKYZLCLFPHBDBJ-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 96.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.53 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|