C15H22F3N3O2 — CID 123709283
4-[[2-[[1-methyl-3-(trifluoromethyl)pyrazol-5-yl]oxymethyl]cyclobutyl]methyl]morpholine (PubChem CID 123709283) has the molecular formula C15H22F3N3O2 and a molecular weight of 333.35 g/mol. Its IUPAC name is 4-[[2-[[1-methyl-3-(trifluoromethyl)pyrazol-5-yl]oxymethyl]cyclobutyl]methyl]morpholine.
| Compound Name | 4-[[2-[[1-methyl-3-(trifluoromethyl)pyrazol-5-yl]oxymethyl]cyclobutyl]methyl]morpholine |
|---|---|
| PubChem CID | 123709283 |
| Molecular Formula | C15H22F3N3O2 |
| Molecular Weight | 333.35 g/mol |
| Exact Mass | 333.17 |
| IUPAC Name | 4-[[2-[[1-methyl-3-(trifluoromethyl)pyrazol-5-yl]oxymethyl]cyclobutyl]methyl]morpholine |
| SMILES | Cn1nc(C(F)(F)F)cc1OCC1CCC1CN1CCOCC1 |
| InChI | InChI=1S/C15H22F3N3O2/c1-20-14(8-13(19-20)15(16,17)18)23-10-12-3-2-11(12)9-21-4-6-22-7-5-21/h8,11-12H,2-7,9-10H2,1H3 |
| InChIKey | XJYFPDNNZNBRNN-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 39.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.35 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |