C19H13BrCl2F3NO3 — CID 123709444
methyl 2-(bromomethyl)-5-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-2H-1,2-oxazol-3-yl]benzoate (PubChem CID 123709444) has the molecular formula C19H13BrCl2F3NO3 and a molecular weight of 511.12 g/mol. Its IUPAC name is methyl 2-(bromomethyl)-5-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-2H-1,2-oxazol-3-yl]benzoate.
| Compound Name | methyl 2-(bromomethyl)-5-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-2H-1,2-oxazol-3-yl]benzoate |
|---|---|
| PubChem CID | 123709444 |
| Molecular Formula | C19H13BrCl2F3NO3 |
| Molecular Weight | 511.12 g/mol |
| Exact Mass | 508.94 |
| IUPAC Name | methyl 2-(bromomethyl)-5-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-2H-1,2-oxazol-3-yl]benzoate |
| SMILES | COC(=O)c1cc(C2=CC(c3cc(Cl)cc(Cl)c3)(C(F)(F)F)ON2)ccc1CBr |
| InChI | InChI=1S/C19H13BrCl2F3NO3/c1-28-17(27)15-4-10(2-3-11(15)9-20)16-8-18(29-26-16,19(23,24)25)12-5-13(21)7-14(22)6-12/h2-8,26H,9H2,1H3 |
| InChIKey | NURWSZSFSPPQRN-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.12 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|