C17H11Cl2F3INO — CID 91546984
5-(3,5-dichlorophenyl)-3-(3-iodo-4-methylphenyl)-5-(trifluoromethyl)-2H-1,2-oxazole (PubChem CID 91546984) has the molecular formula C17H11Cl2F3INO and a molecular weight of 500.09 g/mol. Its IUPAC name is 5-(3,5-dichlorophenyl)-3-(3-iodo-4-methylphenyl)-5-(trifluoromethyl)-2H-1,2-oxazole.
| Compound Name | 5-(3,5-dichlorophenyl)-3-(3-iodo-4-methylphenyl)-5-(trifluoromethyl)-2H-1,2-oxazole |
|---|---|
| PubChem CID | 91546984 |
| Molecular Formula | C17H11Cl2F3INO |
| Molecular Weight | 500.09 g/mol |
| Exact Mass | 498.92 |
| IUPAC Name | 5-(3,5-dichlorophenyl)-3-(3-iodo-4-methylphenyl)-5-(trifluoromethyl)-2H-1,2-oxazole |
| SMILES | Cc1ccc(C2=CC(c3cc(Cl)cc(Cl)c3)(C(F)(F)F)ON2)cc1I |
| InChI | InChI=1S/C17H11Cl2F3INO/c1-9-2-3-10(4-14(9)23)15-8-16(25-24-15,17(20,21)22)11-5-12(18)7-13(19)6-11/h2-8,24H,1H3 |
| InChIKey | IAPIXUUXVVRESB-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.09 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|