C17H13Cl2F3N2O — CID 91073617
3-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-2H-1,2-oxazol-3-yl]-5-methylaniline (PubChem CID 91073617) has the molecular formula C17H13Cl2F3N2O and a molecular weight of 389.20 g/mol. Its IUPAC name is 3-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-2H-1,2-oxazol-3-yl]-5-methylaniline.
| Compound Name | 3-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-2H-1,2-oxazol-3-yl]-5-methylaniline |
|---|---|
| PubChem CID | 91073617 |
| Molecular Formula | C17H13Cl2F3N2O |
| Molecular Weight | 389.20 g/mol |
| Exact Mass | 388.04 |
| IUPAC Name | 3-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-2H-1,2-oxazol-3-yl]-5-methylaniline |
| SMILES | Cc1cc(N)cc(C2=CC(c3cc(Cl)cc(Cl)c3)(C(F)(F)F)ON2)c1 |
| InChI | InChI=1S/C17H13Cl2F3N2O/c1-9-2-10(4-14(23)3-9)15-8-16(25-24-15,17(20,21)22)11-5-12(18)7-13(19)6-11/h2-8,24H,23H2,1H3 |
| InChIKey | MMIVZAPZEWFAES-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.20 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|