C17H13Cl3F3N3O — CID 123861772
1-[2-chloro-5-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-2H-1,2-oxazol-3-yl]phenyl]-1-methylhydrazine (PubChem CID 123861772) has the molecular formula C17H13Cl3F3N3O and a molecular weight of 438.66 g/mol. Its IUPAC name is 1-[2-chloro-5-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-2H-1,2-oxazol-3-yl]phenyl]-1-methylhydrazine.
| Compound Name | 1-[2-chloro-5-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-2H-1,2-oxazol-3-yl]phenyl]-1-methylhydrazine |
|---|---|
| PubChem CID | 123861772 |
| Molecular Formula | C17H13Cl3F3N3O |
| Molecular Weight | 438.66 g/mol |
| Exact Mass | 437.01 |
| IUPAC Name | 1-[2-chloro-5-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-2H-1,2-oxazol-3-yl]phenyl]-1-methylhydrazine |
| SMILES | CN(N)c1cc(C2=CC(c3cc(Cl)cc(Cl)c3)(C(F)(F)F)ON2)ccc1Cl |
| InChI | InChI=1S/C17H13Cl3F3N3O/c1-26(24)15-4-9(2-3-13(15)20)14-8-16(27-25-14,17(21,22)23)10-5-11(18)7-12(19)6-10/h2-8,25H,24H2,1H3 |
| InChIKey | UJGNVPOYAJYDMF-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 50.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.66 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|