C16H9Cl2F3N2O4 — CID 91414480
5-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-2H-1,2-oxazol-3-yl]-2-nitrophenol (PubChem CID 91414480) has the molecular formula C16H9Cl2F3N2O4 and a molecular weight of 421.16 g/mol. Its IUPAC name is 5-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-2H-1,2-oxazol-3-yl]-2-nitrophenol.
| Compound Name | 5-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-2H-1,2-oxazol-3-yl]-2-nitrophenol |
|---|---|
| PubChem CID | 91414480 |
| Molecular Formula | C16H9Cl2F3N2O4 |
| Molecular Weight | 421.16 g/mol |
| Exact Mass | 419.99 |
| IUPAC Name | 5-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-2H-1,2-oxazol-3-yl]-2-nitrophenol |
| SMILES | O=[N+]([O-])c1ccc(C2=CC(c3cc(Cl)cc(Cl)c3)(C(F)(F)F)ON2)cc1O |
| InChI | InChI=1S/C16H9Cl2F3N2O4/c17-10-4-9(5-11(18)6-10)15(16(19,20)21)7-12(22-27-15)8-1-2-13(23(25)26)14(24)3-8/h1-7,22,24H |
| InChIKey | STXLEYXUCQOUIU-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 84.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.16 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|