C20H16Cl3F3N2O3 — CID 91474632
2-chloroethyl N-[5-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-2H-1,2-oxazol-3-yl]-2-methylphenyl]carbamate (PubChem CID 91474632) has the molecular formula C20H16Cl3F3N2O3 and a molecular weight of 495.71 g/mol. Its IUPAC name is 2-chloroethyl N-[5-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-2H-1,2-oxazol-3-yl]-2-methylphenyl]carbamate.
| Compound Name | 2-chloroethyl N-[5-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-2H-1,2-oxazol-3-yl]-2-methylphenyl]carbamate |
|---|---|
| PubChem CID | 91474632 |
| Molecular Formula | C20H16Cl3F3N2O3 |
| Molecular Weight | 495.71 g/mol |
| Exact Mass | 494.02 |
| IUPAC Name | 2-chloroethyl N-[5-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-2H-1,2-oxazol-3-yl]-2-methylphenyl]carbamate |
| SMILES | Cc1ccc(C2=CC(c3cc(Cl)cc(Cl)c3)(C(F)(F)F)ON2)cc1NC(=O)OCCCl |
| InChI | InChI=1S/C20H16Cl3F3N2O3/c1-11-2-3-12(6-16(11)27-18(29)30-5-4-21)17-10-19(31-28-17,20(24,25)26)13-7-14(22)9-15(23)8-13/h2-3,6-10,28H,4-5H2,1H3,(H,27,29) |
| InChIKey | TZXXFNPWHYQINS-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.71 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|