C24H23Cl2F3N2O4 — CID 90841079
tert-butyl 2-[[4-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-2H-1,2-oxazol-3-yl]-2-methylphenyl]methylideneamino]oxyacetate (PubChem CID 90841079) has the molecular formula C24H23Cl2F3N2O4 and a molecular weight of 531.36 g/mol. Its IUPAC name is tert-butyl 2-[[4-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-2H-1,2-oxazol-3-yl]-2-methylphenyl]methylideneamino]oxyacetate.
| Compound Name | tert-butyl 2-[[4-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-2H-1,2-oxazol-3-yl]-2-methylphenyl]methylideneamino]oxyacetate |
|---|---|
| PubChem CID | 90841079 |
| Molecular Formula | C24H23Cl2F3N2O4 |
| Molecular Weight | 531.36 g/mol |
| Exact Mass | 530.10 |
| IUPAC Name | tert-butyl 2-[[4-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-2H-1,2-oxazol-3-yl]-2-methylphenyl]methylideneamino]oxyacetate |
| SMILES | Cc1cc(C2=CC(c3cc(Cl)cc(Cl)c3)(C(F)(F)F)ON2)ccc1C=NOCC(=O)OC(C)(C)C |
| InChI | InChI=1S/C24H23Cl2F3N2O4/c1-14-7-15(5-6-16(14)12-30-33-13-21(32)34-22(2,3)4)20-11-23(35-31-20,24(27,28)29)17-8-18(25)10-19(26)9-17/h5-12,31H,13H2,1-4H3 |
| InChIKey | MZMHBARTZSHMRQ-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 69.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.36 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|