C21H16Cl2F5N3O4 — CID 136658871
4-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-2H-1,2-oxazol-3-yl]-2-(difluoromethoxy)-N-(ethoxyiminomethyl)benzamide (PubChem CID 136658871) has the molecular formula C21H16Cl2F5N3O4 and a molecular weight of 540.27 g/mol. Its IUPAC name is 4-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-2H-1,2-oxazol-3-yl]-2-(difluoromethoxy)-N-(ethoxyiminomethyl)benzamide.
| Compound Name | 4-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-2H-1,2-oxazol-3-yl]-2-(difluoromethoxy)-N-(ethoxyiminomethyl)benzamide |
|---|---|
| PubChem CID | 136658871 |
| Molecular Formula | C21H16Cl2F5N3O4 |
| Molecular Weight | 540.27 g/mol |
| Exact Mass | 539.04 |
| IUPAC Name | 4-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-2H-1,2-oxazol-3-yl]-2-(difluoromethoxy)-N-(ethoxyiminomethyl)benzamide |
| SMILES | CCON=CNC(=O)c1ccc(C2=CC(c3cc(Cl)cc(Cl)c3)(C(F)(F)F)ON2)cc1OC(F)F |
| InChI | InChI=1S/C21H16Cl2F5N3O4/c1-2-33-30-10-29-18(32)15-4-3-11(5-17(15)34-19(24)25)16-9-20(35-31-16,21(26,27)28)12-6-13(22)8-14(23)7-12/h3-10,19,31H,2H2,1H3,(H,29,30,32) |
| InChIKey | OKWYWYPUZMXMOD-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.27 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|