C32H29N6O3+ — CID 123709792
methyl 1-[[4-[2-(1-benzyltetrazol-5-yl)phenyl]phenyl]methyl]-2-ethoxy-3H-benzimidazol-1-ium-4-carboxylate (PubChem CID 123709792) has the molecular formula C32H29N6O3+ and a molecular weight of 545.62 g/mol. Its IUPAC name is methyl 1-[[4-[2-(1-benzyltetrazol-5-yl)phenyl]phenyl]methyl]-2-ethoxy-3H-benzimidazol-1-ium-4-carboxylate.
| Compound Name | methyl 1-[[4-[2-(1-benzyltetrazol-5-yl)phenyl]phenyl]methyl]-2-ethoxy-3H-benzimidazol-1-ium-4-carboxylate |
|---|---|
| PubChem CID | 123709792 |
| Molecular Formula | C32H29N6O3+ |
| Molecular Weight | 545.62 g/mol |
| Exact Mass | 545.23 |
| IUPAC Name | methyl 1-[[4-[2-(1-benzyltetrazol-5-yl)phenyl]phenyl]methyl]-2-ethoxy-3H-benzimidazol-1-ium-4-carboxylate |
| SMILES | CCOc1[nH]c2c(C(=O)OC)cccc2[n+]1Cc1ccc(-c2ccccc2-c2nnnn2Cc2ccccc2)cc1 |
| InChI | InChI=1S/C32H28N6O3/c1-3-41-32-33-29-27(31(39)40-2)14-9-15-28(29)37(32)20-23-16-18-24(19-17-23)25-12-7-8-13-26(25)30-34-35-36-38(30)21-22-10-5-4-6-11-22/h4-19H,3,20-21H2,1-2H3/p+1 |
| InChIKey | NSJDCBCGTYCIPB-UHFFFAOYSA-O |
| XLogP | 5.06 |
| TPSA | 98.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.62 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|